CAS 1000341-81-0: 4-Bromo-7-chloro-1H-pyrrolo[3,2-c]pyridine
Description:4-Bromo-7-chloro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature. Its molecular structure allows for various interactions, making it a candidate for studies in drug development, particularly in targeting specific biological pathways. The compound's reactivity can be influenced by the halogen substituents, which can participate in electrophilic aromatic substitution reactions. Additionally, the presence of nitrogen atoms in the ring structure may impart basic properties, allowing it to form salts with acids. Overall, 4-Bromo-7-chloro-1H-pyrrolo[3,2-c]pyridine is of interest for its potential applications in pharmaceuticals and as a building block in organic synthesis.
Formula:C7H4BrClN2
InChI:InChI=1S/C7H4BrClN2/c8-7-4-1-2-10-6(4)5(9)3-11-7/h1-3,10H
InChI key:InChIKey=QULWOGLBWMRZGR-UHFFFAOYSA-N
SMILES:ClC1=CN=C(Br)C=2C=CNC12
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Pyrrolo[3,2-c]pyridine, 4-broMo-7-chloro- REF: IN-DA0000IBCAS: 1000341-81-0 | 98% | To inquire | Tue 11 Mar 25 |
![]() | 4-Bromo-7-chloro-1H-pyrrolo[3,2-c]pyridine REF: 10-F337376CAS: 1000341-81-0 | 95.0% | To inquire | Wed 19 Mar 25 |
![]() | 4-Bromo-7-chloro-5-azaindole REF: 3D-AQB34181CAS: 1000341-81-0 | Min. 95% | - - - | Discontinued product |

1H-Pyrrolo[3,2-c]pyridine, 4-broMo-7-chloro-
Ref: IN-DA0000IB
50mg | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

4-Bromo-7-chloro-1H-pyrrolo[3,2-c]pyridine
Ref: 10-F337376
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

4-Bromo-7-chloro-5-azaindole
Ref: 3D-AQB34181
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |