CymitQuimica logo

CAS 1000341-82-1

:

4-Chloro-7-iodo-1H-indole

Description:
4-Chloro-7-iodo-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of chlorine and iodine substituents at the 4 and 7 positions, respectively, significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent's polarity. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The halogen substituents can enhance the compound's lipophilicity and may also affect its interaction with biological targets. Additionally, 4-Chloro-7-iodo-1H-indole may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.
Formula:C8H5ClIN
InChI:InChI=1S/C8H5ClIN/c9-6-1-2-7(10)8-5(6)3-4-11-8/h1-4,11H
InChI key:InChIKey=KUEVAPHSWQGJLC-UHFFFAOYSA-N
SMILES:ClC1=C2C(=C(I)C=C1)NC=C2
Synonyms:
  • 4-Chloro-7-iodo-1H-indole
  • 1H-Indole, 4-chloro-7-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.