CymitQuimica logo

CAS 1000341-91-2

:

4-Bromo-7-chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine

Description:
4-Bromo-7-chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine framework. This compound features three halogen substituents: bromine, chlorine, and iodine, which significantly influence its chemical reactivity and physical properties. The presence of these halogens can enhance the compound's potential for biological activity, making it of interest in medicinal chemistry and drug development. Typically, such halogenated compounds exhibit unique solubility characteristics and may participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The compound's molecular structure contributes to its potential applications in pharmaceuticals, particularly in the development of targeted therapies. Additionally, its stability and reactivity can be influenced by the electronic effects of the halogen atoms, which can affect the compound's interaction with biological targets. Overall, 4-Bromo-7-chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine represents a valuable compound for further research in organic synthesis and medicinal applications.
Formula:C7H3BrClIN2
InChI:InChI=1S/C7H3BrClIN2/c8-7-5-4(10)2-11-6(5)3(9)1-12-7/h1-2,11H
InChI key:InChIKey=BYBXJLLCESHHMZ-UHFFFAOYSA-N
SMILES:ClC1=C2C(C(I)=CN2)=C(Br)N=C1
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine, 4-bromo-7-chloro-3-iodo-
  • 4-Bromo-7-chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.