CAS 1000341-94-5: 4-Chloro-7-fluoro-3-iodo-1H-indazole

Description:4-Chloro-7-fluoro-3-iodo-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of halogen substituents—specifically chlorine, fluorine, and iodine—at positions 4, 7, and 3, respectively, significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is likely to be soluble in organic solvents but may have limited solubility in water due to its hydrophobic nature. The halogen atoms can impart unique electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, which could be explored for potential pharmaceutical applications. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.

Formula:C₇H₃ClFIN₂

InChI:InChI=1S/C7H3ClFIN2/c8-3-1-2-4(9)6-5(3)7(10)12-11-6/h1-2H,(H,11,12)

InChI key:InChIKey=HTGYHKGSVQCIQY-UHFFFAOYSA-N

SMILES:FC1=CC=C(Cl)C=2C(I)=NNC12