CAS 1000341-96-7
:4,7-Dichloro-3-iodo-1H-indazole
Description:
4,7-Dichloro-3-iodo-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two chlorine atoms at the 4 and 7 positions and an iodine atom at the 3 position contributes to its unique reactivity and potential applications in various fields, including medicinal chemistry and material science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its halogen substituents can influence its electronic properties, making it a candidate for further functionalization or use in synthesis. Additionally, the presence of halogens often enhances biological activity, which may be of interest in drug development. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 4,7-Dichloro-3-iodo-1H-indazole represents a versatile structure for research and development in chemical and pharmaceutical applications.
Formula:C7H3Cl2IN2
InChI:InChI=1S/C7H3Cl2IN2/c8-3-1-2-4(9)6-5(3)7(10)12-11-6/h1-2H,(H,11,12)
InChI key:InChIKey=BPRIVWBGIQHFCS-UHFFFAOYSA-N
SMILES:ClC1=C2C(C(I)=NN2)=C(Cl)C=C1
Synonyms:- 4,7-Dichloro-3-iodo-1H-indazole
- 1H-Indazole, 4,7-dichloro-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
