CAS 1000342-00-6
:4-Chloro-3-iodo-7-methoxy-1H-indazole
Description:
4-Chloro-3-iodo-7-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of chlorine and iodine substituents at the 4 and 3 positions, respectively, introduces significant halogen functionality, which can influence the compound's reactivity and biological activity. The methoxy group at the 7 position enhances its solubility and can affect its electronic properties. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, and the halogen atoms may contribute to its lipophilicity and ability to penetrate biological membranes. As with many halogenated compounds, it is essential to consider the environmental and health implications of its use, including potential toxicity and bioaccumulation. Overall, 4-Chloro-3-iodo-7-methoxy-1H-indazole represents a unique structure with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H6ClIN2O
InChI:InChI=1S/C8H6ClIN2O/c1-13-5-3-2-4(9)6-7(5)11-12-8(6)10/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=QTBJWNKEPXUZNF-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(Cl)C=C1)C(I)=NN2
Synonyms:- 1H-Indazole, 4-chloro-3-iodo-7-methoxy-
- 4-Chloro-3-iodo-7-methoxy-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
