CAS 1000342-03-9
:6-Bromo-3-methyl-1H-indazol-4-amine
Description:
6-Bromo-3-methyl-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 6-position and a methyl group at the 3-position contributes to its unique reactivity and potential biological activity. This compound is typically used in medicinal chemistry and research due to its potential as a pharmacological agent. It may exhibit properties such as anti-inflammatory, anti-cancer, or antimicrobial activities, although specific biological effects would depend on further studies. The amine functional group at the 4-position enhances its solubility and reactivity, making it a versatile building block in organic synthesis. Additionally, the compound's molecular structure allows for various modifications, which can lead to the development of derivatives with enhanced efficacy or selectivity in biological applications. As with many chemical substances, safety data and handling precautions should be observed, particularly due to the presence of bromine, which can pose health risks.
Formula:C8H8BrN3
InChI:InChI=1S/C8H8BrN3/c1-4-8-6(10)2-5(9)3-7(8)12-11-4/h2-3H,10H2,1H3,(H,11,12)
InChI key:InChIKey=XMAMFUFNVSKGRF-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(Br)=C1)NN=C2C
Synonyms:- 1H-Indazol-4-amine, 6-bromo-3-methyl-
- 6-Bromo-3-methyl-1H-indazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
