
CAS 1000342-06-2
:4,7-Difluoro-3-iodo-1H-indazole
Description:
4,7-Difluoro-3-iodo-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of two fluorine atoms at the 4 and 7 positions and an iodine atom at the 3 position contributes to its unique chemical properties, including increased reactivity and potential for various applications in medicinal chemistry and material science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential for interactions with biological targets, making it of interest in drug discovery. The presence of halogens (fluorine and iodine) can enhance lipophilicity and influence the compound's pharmacokinetic properties. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the halogen substituents. Overall, 4,7-Difluoro-3-iodo-1H-indazole is a compound of interest for further research in various chemical and pharmaceutical applications.
Formula:C7H3F2IN2
InChI:InChI=1S/C7H3F2IN2/c8-3-1-2-4(9)6-5(3)7(10)12-11-6/h1-2H,(H,11,12)
InChI key:InChIKey=TYGHMUGMVQEKTP-UHFFFAOYSA-N
SMILES:FC1=C2C(C(I)=NN2)=C(F)C=C1
Synonyms:- 1H-Indazole, 4,7-difluoro-3-iodo-
- 4,7-Difluoro-3-iodo-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
