CAS 1000342-12-0
:7-Bromo-4-fluoro-3-iodo-1H-indazole
Description:
7-Bromo-4-fluoro-3-iodo-1H-indazole is a heterocyclic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of bromine, fluorine, and iodine substituents at specific positions (7, 4, and 3, respectively) contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent and conditions. The halogen substituents can influence the compound's electronic properties, making it potentially useful in various applications, including medicinal chemistry and material science. Its structure may also impart interesting biological activities, which could be explored in drug discovery. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 7-Bromo-4-fluoro-3-iodo-1H-indazole represents a complex and versatile chemical entity with potential implications in various fields of research.
Formula:C7H3BrFIN2
InChI:InChI=1S/C7H3BrFIN2/c8-3-1-2-4(9)5-6(3)11-12-7(5)10/h1-2H,(H,11,12)
InChI key:InChIKey=RLJHUUKWNIRZOK-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(I)=NN2)=C(F)C=C1
Synonyms:- 7-Bromo-4-fluoro-3-iodo-1H-indazole
- 1H-Indazole, 7-bromo-4-fluoro-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
