CAS 1000342-17-5
:3-Bromo-4-methoxy-6-methyl-1H-indazole
Description:
3-Bromo-4-methoxy-6-methyl-1H-indazole is a chemical compound belonging to the indazole class, characterized by its bicyclic structure that includes a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 3-position and a methoxy group at the 4-position, along with a methyl group at the 6-position, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the bromine atom can serve as a site for further substitution reactions, enhancing its utility in synthetic organic chemistry. As with many indazole derivatives, it may also exhibit biological activity, making it of interest for research in drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C9H9BrN2O
InChI:InChI=1S/C9H9BrN2O/c1-5-3-6-8(7(4-5)13-2)9(10)12-11-6/h3-4H,1-2H3,(H,11,12)
InChI key:InChIKey=VHMNCPDDIVQCQS-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(NN=C2Br)=CC(C)=C1
Synonyms:- 3-Bromo-4-methoxy-6-methyl-1H-indazole
- 1H-Indazole, 3-bromo-4-methoxy-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.