CAS 1000342-25-5: Ethyl 5-(hydroxymethyl)-2-thiophenecarboxylate

Description:Ethyl 5-(hydroxymethyl)-2-thiophenecarboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylate functional group, which contributes to its reactivity and solubility in polar solvents. The presence of the hydroxymethyl group enhances its potential for further chemical modifications, making it a versatile intermediate in organic synthesis. Ethyl esters typically exhibit moderate volatility and can be used in various applications, including pharmaceuticals and agrochemicals. The compound's structure suggests it may participate in reactions such as esterification, nucleophilic substitution, and condensation, depending on the reaction conditions. Additionally, the thiophene moiety may impart unique electronic properties, making it of interest in materials science and organic electronics. Overall, Ethyl 5-(hydroxymethyl)-2-thiophenecarboxylate is a valuable compound in synthetic organic chemistry, with potential applications in diverse fields.

Formula:C₈H₁₀O₃S

InChI:InChI=1S/C8H10O3S/c1-2-11-8(10)7-4-3-6(5-9)12-7/h3-4,9H,2,5H2,1H3

InChI key:InChIKey=RRYJRGXPFSRDHI-UHFFFAOYSA-N

SMILES:O=C(OCC)C=1SC(=CC1)CO