CymitQuimica logo

CAS 1000342-30-2

:

Methyl 5-bromo-1H-indazole-6-carboxylate

Description:
Methyl 5-bromo-1H-indazole-6-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and a carboxylate group at the 6-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The methyl ester functional group enhances its solubility in organic solvents, making it suitable for various chemical reactions. This compound may exhibit biological activity, which can be explored for pharmaceutical applications, particularly in the development of new drugs. Its molecular structure allows for potential interactions with biological targets, making it of interest in research related to cancer, inflammation, or other therapeutic areas. As with many brominated compounds, it may also possess unique properties such as increased lipophilicity or altered electronic characteristics, which can influence its behavior in biological systems. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-14-9(13)6-3-8-5(2-7(6)10)4-11-12-8/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=OMGXGABLIDYSNN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C2C(=CC1Br)C=NN2
Synonyms:
  • Methyl 5-bromo-1H-indazole-6-carboxylate
  • 1H-Indazole-6-carboxylic acid, 5-bromo-, methyl ester
Found 5 products.