CAS 1000342-41-5
:3-Bromo-6-chloro-5-nitro-1H-indazole
Description:
3-Bromo-6-chloro-5-nitro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of bromine, chlorine, and nitro substituents at specific positions on the indazole structure contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may show limited solubility in water due to its hydrophobic nature. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the halogen substituents (bromo and chloro) can participate in nucleophilic substitution reactions, making this compound of interest in synthetic organic chemistry. Its potential applications may include use in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of halogens and nitro groups, which can pose health and environmental risks.
Formula:C7H3BrClN3O2
InChI:InChI=1S/C7H3BrClN3O2/c8-7-3-1-6(12(13)14)4(9)2-5(3)10-11-7/h1-2H,(H,10,11)
InChI key:InChIKey=FGYSCNYPUOOGLY-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC(Cl)=C(N(=O)=O)C2)NN1
Synonyms:- 3-Bromo-6-chloro-5-nitro-1H-indazole
- 1H-Indazole, 3-bromo-6-chloro-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
