
CAS 1000342-44-8
:3-Bromo-6-chloro-1H-indazol-5-amine
Description:
3-Bromo-6-chloro-1H-indazol-5-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of bromine and chlorine substituents at the 3 and 6 positions, respectively, contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may have specific interactions with biological targets, making it of interest in drug discovery and development. The amine functional group at the 5-position can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's unique halogen substitutions may influence its electronic properties and steric effects, which are crucial for its biological activity. Overall, 3-Bromo-6-chloro-1H-indazol-5-amine represents a versatile scaffold for further chemical modifications and investigations in the field of pharmaceuticals.
Formula:C7H5BrClN3
InChI:InChI=1S/C7H5BrClN3/c8-7-3-1-5(10)4(9)2-6(3)11-12-7/h1-2H,10H2,(H,11,12)
InChI key:InChIKey=URWUDZSHAMWGQP-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC(Cl)=C(N)C2)NN1
Synonyms:- 1H-Indazol-5-amine, 3-bromo-6-chloro-
- 3-Bromo-6-chloro-1H-indazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
