CAS 1000342-48-2
:4-Bromo-3-iodo-1H-indazole-6-carbonitrile
Description:
4-Bromo-3-iodo-1H-indazole-6-carbonitrile is a heterocyclic organic compound characterized by the presence of both bromine and iodine substituents on the indazole ring, along with a cyano group (-C≡N) at the 6-position. This compound features a fused bicyclic structure, which contributes to its unique chemical properties. The presence of halogens (bromine and iodine) typically enhances the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The cyano group introduces a polar functional group, which can influence solubility and reactivity. Additionally, the indazole moiety is known for its biological activity, making derivatives of this compound of interest in drug discovery. The compound's molecular structure allows for potential interactions with biological targets, and its unique combination of substituents may impart specific pharmacological properties. As with many halogenated compounds, care should be taken regarding their environmental impact and toxicity.
Formula:C8H3BrIN3
InChI:InChI=1S/C8H3BrIN3/c9-5-1-4(3-11)2-6-7(5)8(10)13-12-6/h1-2H,(H,12,13)
InChI key:InChIKey=QJAVJYWHXWCCIQ-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(C#N)=C1)NN=C2I
Synonyms:- 1H-Indazole-6-carbonitrile, 4-bromo-3-iodo-
- 4-Bromo-3-iodo-1H-indazole-6-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
