
CAS 1000342-49-3
:3-Iodo-6-methyl-1H-indazol-7-amine
Description:
3-Iodo-6-methyl-1H-indazol-7-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 3-position and a methyl group at the 6-position contributes to its unique reactivity and properties. The amine functional group at the 7-position enhances its potential for hydrogen bonding and nucleophilic reactivity. This compound is typically used in medicinal chemistry and research, particularly in the development of pharmaceuticals due to its potential biological activity. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in drug discovery. Additionally, the iodine substituent can influence the compound's lipophilicity and metabolic stability. As with many indazole derivatives, it may exhibit a range of pharmacological effects, including anti-inflammatory or anticancer properties, although specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed due to the presence of iodine and the potential for biological activity.
Formula:C8H8IN3
InChI:InChI=1S/C8H8IN3/c1-4-2-3-5-7(6(4)10)11-12-8(5)9/h2-3H,10H2,1H3,(H,11,12)
InChI key:InChIKey=ZVYXLHUDUFLFID-UHFFFAOYSA-N
SMILES:NC1=C2C(C(I)=NN2)=CC=C1C
Synonyms:- 1H-Indazol-7-amine, 3-iodo-6-methyl-
- 3-Iodo-6-methyl-1H-indazol-7-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
