CAS 1000342-50-6
:6-Chloro-3-iodo-1H-indazol-5-amine
Description:
6-Chloro-3-iodo-1H-indazol-5-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of chlorine and iodine substituents at specific positions on the indazole ring contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water, depending on the specific conditions. It is often used in medicinal chemistry and research due to its potential as a pharmacophore in drug development. The presence of halogen atoms can influence the compound's electronic properties, making it a candidate for various applications, including as a building block in the synthesis of more complex molecules. Additionally, the compound's structure may allow for interactions with biological targets, which is of interest in the fields of biochemistry and pharmacology. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H5ClIN3
InChI:InChI=1S/C7H5ClIN3/c8-4-2-6-3(1-5(4)10)7(9)12-11-6/h1-2H,10H2,(H,11,12)
InChI key:InChIKey=LNTSOWANOHXTLS-UHFFFAOYSA-N
SMILES:IC=1C=2C(=CC(Cl)=C(N)C2)NN1
Synonyms:- 6-Chloro-3-iodo-1H-indazol-5-amine
- 1H-Indazol-5-amine, 6-chloro-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
