CAS 1000342-57-3
:4-Bromo-3-chloro-1H-indazole-6-carbonitrile
Description:
4-Bromo-3-chloro-1H-indazole-6-carbonitrile is a heterocyclic organic compound characterized by the presence of both bromine and chlorine substituents on the indazole ring, as well as a cyano group (-C≡N) at the 6-position. This compound features a fused bicyclic structure, which contributes to its unique chemical properties. The presence of halogens (bromine and chlorine) typically enhances the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The cyano group can participate in nucleophilic reactions and is often involved in the formation of other functional groups. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 4-Bromo-3-chloro-1H-indazole-6-carbonitrile is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C8H3BrClN3
InChI:InChI=1S/C8H3BrClN3/c9-5-1-4(3-11)2-6-7(5)8(10)13-12-6/h1-2H,(H,12,13)
InChI key:InChIKey=LNMNHKJZCMENNS-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(C#N)=C1)NN=C2Cl
Synonyms:- 1H-Indazole-6-carbonitrile, 4-bromo-3-chloro-
- 4-Bromo-3-chloro-1H-indazole-6-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
