CymitQuimica logo

CAS 1000342-58-4

:

6-Bromo-2,3-dihydro-4-methoxy-1H-indole

Description:
6-Bromo-2,3-dihydro-4-methoxy-1H-indole is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a methoxy group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic indole framework. The methoxy group enhances its electron-donating characteristics, potentially influencing its reactivity and interactions with biological systems. As a derivative of indole, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's reactivity can be attributed to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Overall, 6-Bromo-2,3-dihydro-4-methoxy-1H-indole is notable for its structural features and potential applications in various chemical and biological contexts.
Formula:C9H10BrNO
InChI:InChI=1S/C9H10BrNO/c1-12-9-5-6(10)4-8-7(9)2-3-11-8/h4-5,11H,2-3H2,1H3
InChI key:InChIKey=KZYMTDHZMMOCIV-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(Br)=C1)NCC2
Synonyms:
  • 6-Bromo-2,3-dihydro-4-methoxy-1H-indole
  • 1H-Indole, 6-bromo-2,3-dihydro-4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.