CAS 1000342-62-0
:1H-Pyrrolo[3,2-c]pyridin-3-amine
Description:
1H-Pyrrolo[3,2-c]pyridin-3-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features an amino group (-NH2) at the 3-position of the pyrrolo ring, which contributes to its reactivity and potential biological activity. It typically exhibits properties such as moderate solubility in polar solvents and may participate in hydrogen bonding due to the presence of the amino group. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit interesting biological properties, including antimicrobial and anticancer activities. Additionally, the presence of nitrogen atoms in the ring system can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and cyclizations. Overall, 1H-Pyrrolo[3,2-c]pyridin-3-amine is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C7H7N3
InChI:InChI=1S/C7H7N3/c8-6-4-10-7-1-2-9-3-5(6)7/h1-4,10H,8H2
InChI key:InChIKey=PVXULIOPYOMGME-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CC=NC2)NC1
Synonyms:- 1H-Pyrrolo[3,2-c]pyridin-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
