CymitQuimica logo

CAS 1000342-63-1

:

N-[5-Chloro-2-(hydroxymethyl)-3-nitrophenyl]acetamide

Description:
N-[5-Chloro-2-(hydroxymethyl)-3-nitrophenyl]acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro substituent, a hydroxymethyl group, and a nitro group attached to a phenyl ring, which contributes to its reactivity and potential biological activity. The acetamide moiety indicates the presence of an amide functional group, which can influence the compound's solubility and interaction with biological systems. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in pharmaceutical research. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions or electrophilic aromatic substitutions, due to the presence of electron-withdrawing groups like the nitro and chloro substituents. Additionally, the hydroxymethyl group may provide sites for further functionalization or modification. Overall, N-[5-Chloro-2-(hydroxymethyl)-3-nitrophenyl]acetamide is a compound with potential applications in medicinal chemistry and materials science, warranting further investigation into its properties and uses.
Formula:C9H9ClN2O4
InChI:InChI=1S/C9H9ClN2O4/c1-5(14)11-8-2-6(10)3-9(12(15)16)7(8)4-13/h2-3,13H,4H2,1H3,(H,11,14)
InChI key:InChIKey=DQZBXYQYLBQSDK-UHFFFAOYSA-N
SMILES:C(O)C1=C(N(=O)=O)C=C(Cl)C=C1NC(C)=O
Synonyms:
  • Acetamide, N-[5-chloro-2-(hydroxymethyl)-3-nitrophenyl]-
  • N-[5-Chloro-2-(hydroxymethyl)-3-nitrophenyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.