CAS 1000342-64-2
:3-Iodo-6-methyl-7-nitro-1H-indazole
Description:
3-Iodo-6-methyl-7-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 3-position, a methyl group at the 6-position, and a nitro group at the 7-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The nitro group is known for its electron-withdrawing properties, which can influence the reactivity of the compound in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the iodine substituent can enhance the compound's potential for further functionalization and applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of these functional groups suggests that 3-Iodo-6-methyl-7-nitro-1H-indazole may exhibit biological activity, making it of interest for research in drug discovery and development.
Formula:C8H6IN3O2
InChI:InChI=1S/C8H6IN3O2/c1-4-2-3-5-6(7(4)12(13)14)10-11-8(5)9/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=YUUVGRPLNQJQOD-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(C(I)=NN2)=CC=C1C
Synonyms:- 3-Iodo-6-methyl-7-nitro-1H-indazole
- 1H-Indazole, 3-iodo-6-methyl-7-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
