CymitQuimica logo

CAS 1000342-65-3

:

3-Chloro-1H-pyrrolo[3,2-c]pyridine

Description:
3-Chloro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 3-position of the pyrrole ring enhances its reactivity and influences its electronic properties. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. Its structure allows for potential interactions with biological targets, which has led to interest in its pharmacological properties. Additionally, the compound may participate in electrophilic substitution reactions due to the electron-withdrawing nature of the chlorine substituent. Overall, 3-Chloro-1H-pyrrolo[3,2-c]pyridine is notable for its structural complexity and potential utility in the development of new therapeutic agents or as a building block in organic synthesis.
Formula:C7H5ClN2
InChI:InChI=1S/C7H5ClN2/c8-6-4-10-7-1-2-9-3-5(6)7/h1-4,10H
InChI key:InChIKey=SMQIJLFZFORHTQ-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=CC=NC2)NC1
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine, 3-chloro-
  • 3-Chloro-1H-pyrrolo[3,2-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.