CAS 1000342-67-5
:3,6-Dibromo-1H-indazole-4-carbonitrile
Description:
3,6-Dibromo-1H-indazole-4-carbonitrile is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two bromine atoms at the 3 and 6 positions of the indazole ring significantly influences its reactivity and physical properties, such as increasing its lipophilicity and potentially enhancing its biological activity. The carbonitrile functional group at the 4 position introduces a polar character, which can affect solubility and interaction with biological targets. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may contribute to biological activity. Additionally, the presence of halogens like bromine can enhance the compound's stability and reactivity in various chemical reactions. Overall, 3,6-Dibromo-1H-indazole-4-carbonitrile is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C8H3Br2N3
InChI:InChI=1S/C8H3Br2N3/c9-5-1-4(3-11)7-6(2-5)12-13-8(7)10/h1-2H,(H,12,13)
InChI key:InChIKey=YIQRVLQAWVCMLO-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(NN=C2Br)=CC(Br)=C1
Synonyms:- 1H-Indazole-4-carbonitrile, 3,6-dibromo-
- 3,6-Dibromo-1H-indazole-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
