
CAS 1000342-82-4
:1,1-Dimethylethyl 3-(aminooxy)propanoate
Description:
1,1-Dimethylethyl 3-(aminooxy)propanoate, also known by its CAS number 1000342-82-4, is a chemical compound characterized by its ester functional group and the presence of an aminooxy group. This compound features a branched alkyl group, specifically a tert-butyl group, which contributes to its steric properties and potential reactivity. The aminooxy group is known for its ability to form stable adducts with carbonyl compounds, making this substance potentially useful in various synthetic applications, particularly in the field of organic chemistry and bioconjugation. The presence of the propanoate moiety suggests that it may exhibit moderate polarity, influencing its solubility in different solvents. Additionally, the compound's structure may impart specific biological activities, which could be explored in medicinal chemistry. Overall, 1,1-Dimethylethyl 3-(aminooxy)propanoate is a versatile compound with potential applications in chemical synthesis and biological research.
Formula:C7H15NO3
InChI:InChI=1S/C7H15NO3/c1-7(2,3)11-6(9)4-5-10-8/h4-5,8H2,1-3H3
InChI key:InChIKey=AZTMRUDBBGJIEX-UHFFFAOYSA-N
SMILES:O(C(CCON)=O)C(C)(C)C
Synonyms:- Propanoic acid, 3-(aminooxy)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3-(aminooxy)propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.