CAS 1000342-90-4

Methyl 2-cyano-4-pyridineacetate

Description:

Methyl 2-cyano-4-pyridineacetate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-CN) and an ester functional group, specifically a methyl ester, which contributes to its reactivity and solubility properties. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the cyano group imparts notable polarity, making it soluble in polar solvents such as water and alcohols. Methyl 2-cyano-4-pyridineacetate is often utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, due to its ability to participate in nucleophilic reactions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-13-9(12)5-7-2-3-11-8(4-7)6-10/h2-4H,5H2,1H3

InChI key: InChIKey=RZTBBEUAWIPDPR-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C=1C=C(C#N)N=CC1

Synonyms:

• Methyl 2-cyano-4-pyridineacetate
• 4-Pyridineacetic acid, 2-cyano-, methyl ester

4-Pyridineacetic acid, 2-cyano-, methyl ester

CAS: 1000342-90-4

Formula: C₉H₈N₂O₂

Purity: 97%

Molecular weight: 176.1720

Ref: IN-DA0000K0