CAS 1000342-92-6

1-(6-Iodo-1H-indol-1-yl)ethanone

Description:

1-(6-Iodo-1H-indol-1-yl)ethanone is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of the iodo substituent at the 6-position of the indole ring enhances its reactivity and can influence its biological activity. The ethanone functional group indicates that this compound contains a ketone, which contributes to its chemical properties, including its ability to participate in various reactions such as nucleophilic attacks. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, and the halogen substitution can affect lipophilicity and binding affinity. As with many indole derivatives, it may also display fluorescence, which can be useful in various analytical applications. Overall, 1-(6-Iodo-1H-indol-1-yl)ethanone is a versatile compound with potential applications in research and industry.

Formula: C₁₀H₈INO

InChI: InChI=1S/C10H8INO/c1-7(13)12-5-4-8-2-3-9(11)6-10(8)12/h2-6H,1H3

InChI key: InChIKey=FFKBIPHTDBIHPM-UHFFFAOYSA-N

SMILES: C(C)(=O)N1C=2C(C=C1)=CC=C(I)C2

Synonyms:

• 1-(6-Iodo-1H-indol-1-yl)ethan-1-one
• 1-(6-Iodo-1H-indol-1-yl)ethanone
• Ethanone, 1-(6-iodo-1H-indol-1-yl)-
• 1-Acetyl-6-iodoindole

Ethanone, 1-(6-iodo-1H-indol-1-yl)-

CAS: 1000342-92-6

Formula: C₁₀H₈INO

Molecular weight: 285.0811

Ref: IN-DA0000JY