CymitQuimica logo

CAS 1000343-13-4

:

5-Bromo-6-methyl-1H-indole

Description:
5-Bromo-6-methyl-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 5-position and a methyl group at the 6-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and ethanol, but has limited solubility in water. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The bromine substituent can enhance reactivity in electrophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, 5-Bromo-6-methyl-1H-indole may exhibit fluorescence properties, which can be advantageous in various analytical applications. As with many indole derivatives, it may also show interesting interactions with biological targets, warranting further investigation into its pharmacological potential.
Formula:C9H8BrN
InChI:InChI=1S/C9H8BrN/c1-6-4-9-7(2-3-11-9)5-8(6)10/h2-5,11H,1H3
InChI key:InChIKey=VHHRJOFNSFDEHH-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=CC1C)NC=C2
Synonyms:
  • 5-Bromo-6-methyl-1H-indole
  • 1H-Indole, 5-bromo-6-methyl-
Found 5 products.