CAS 1000343-26-9
:1-(7-Bromo-5-chloro-1H-indol-1-yl)ethanone
Description:
1-(7-Bromo-5-chloro-1H-indol-1-yl)ethanone is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of bromine and chlorine substituents at the 7 and 5 positions, respectively, contributes to its unique reactivity and potential biological activity. The ethanone functional group indicates that it contains a carbonyl group (C=O) adjacent to an ethyl group, which can influence its chemical behavior, including its reactivity in nucleophilic addition reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the halogen substituents can enhance lipophilicity and alter the compound's solubility in various solvents, affecting its application in research and industry. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C10H7BrClNO
InChI:InChI=1S/C10H7BrClNO/c1-6(14)13-3-2-7-4-8(12)5-9(11)10(7)13/h2-5H,1H3
InChI key:InChIKey=RWFUEEUCTCXQFE-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(=CC(Cl)=CC2Br)C=C1
Synonyms:- 1-(7-Bromo-5-chloro-1H-indol-1-yl)ethanone
- Ethanone, 1-(7-bromo-5-chloro-1H-indol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
