CAS 1000343-32-7
:1-(5-Amino-7-bromo-1H-indol-1-yl)ethanone
Description:
1-(5-Amino-7-bromo-1H-indol-1-yl)ethanone, with the CAS number 1000343-32-7, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an amino group and a bromo substituent, which contribute to its reactivity and potential biological activity. The ethanone functional group indicates the presence of a carbonyl group adjacent to an ethyl group, which can influence its chemical behavior, including its ability to participate in various reactions such as nucleophilic attacks or condensation reactions. The presence of the amino group suggests potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the bromine atom can serve as a site for further substitution reactions, enhancing its versatility in synthetic applications. Overall, this compound's unique structure and functional groups position it as a candidate for research in pharmaceuticals and organic synthesis.
Formula:C10H9BrN2O
InChI:InChI=1S/C10H9BrN2O/c1-6(14)13-3-2-7-4-8(12)5-9(11)10(7)13/h2-5H,12H2,1H3
InChI key:InChIKey=VDRCNLUSUGCVHY-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(=CC(N)=CC2Br)C=C1
Synonyms:- Ethanone, 1-(5-amino-7-bromo-1H-indol-1-yl)-
- 1-(5-Amino-7-bromo-1H-indol-1-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
