CAS 1000343-84-9
:5-Bromo-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine
Description:
5-Bromo-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrrole functionalities. The presence of bromine, methyl, and nitro groups contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature, while its polar nitro group enhances its interaction with polar solvents. The bromine atom can serve as a site for further chemical modifications, making it a valuable intermediate in synthetic organic chemistry. Additionally, the nitro group may influence the compound's electronic properties, potentially affecting its reactivity in electrophilic substitution reactions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with similar heterocyclic compounds. Overall, 5-Bromo-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine is a versatile compound with significant implications in various chemical research fields.
Formula:C8H6BrN3O2
InChI:InChI=1S/C8H6BrN3O2/c1-4-6(9)2-5-7(12(13)14)3-10-8(5)11-4/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=GCTFWAVAJXTYKT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(=NC(C)=C(Br)C2)NC1
Synonyms:- 5-Bromo-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-6-methyl-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
