CAS 1000343-87-2
:5-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridin-3-amine
Description:
5-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridin-3-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyrrole and pyridine moiety. The presence of a bromine atom at the 5-position and a methyl group at the 6-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amine functional group, which can participate in various chemical reactions. The compound may also exhibit interesting electronic properties owing to the conjugated system formed by the fused rings. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridin-3-amine is of interest for further research in synthetic and medicinal chemistry.
Formula:C8H8BrN3
InChI:InChI=1S/C8H8BrN3/c1-4-6(9)2-5-7(10)3-11-8(5)12-4/h2-3H,10H2,1H3,(H,11,12)
InChI key:InChIKey=VFSMVLHMZHFKFE-UHFFFAOYSA-N
SMILES:NC=1C=2C(=NC(C)=C(Br)C2)NC1
Synonyms:- 1H-Pyrrolo[2,3-b]pyridin-3-amine, 5-bromo-6-methyl-
- 5-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridin-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
