CymitQuimica logo

CAS 100035-75-4

:

Evandamine

Description:
Evandamine, with the CAS number 100035-75-4, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from the plant species of the genus "Evandra," which is known for its medicinal properties. Evandamine exhibits a complex molecular structure, characterized by a bicyclic framework that contributes to its biological activity. This compound has garnered interest in pharmacology due to its potential therapeutic effects, including analgesic and anti-inflammatory properties. Additionally, it may interact with various neurotransmitter systems, which could influence its efficacy in treating certain conditions. The substance is typically studied in the context of natural product chemistry and drug development, where its safety profile and pharmacokinetics are evaluated. As with many alkaloids, the extraction and purification processes are crucial for obtaining Evandamine in a usable form for research and potential therapeutic applications. However, detailed studies on its mechanism of action and broader applications are still ongoing in the scientific community.
Formula:C11H16N4S
InChI:InChI=1/C11H16N4S/c1-7-6-15(14-10(7)12)11-13-8-4-2-3-5-9(8)16-11/h7H,2-6H2,1H3,(H2,12,14)
Synonyms:
  • (- )-2-(3-Amino-5-methyl-2-pyrazolin-1-yl)-4,5,6,7-tetrahydrobenzothiazole.
  • (+-)-2-(3-Amino-5-methyl-2-pyrazolin-1-yl)-4,5,6,7-tetrahydrobenzothiazole
  • 4-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-4,5-dihydro-1H-pyrazol-3-amine
  • UNII-ZG2L2878MD
  • Evandamine [INN]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.