CAS 100036-65-5

6-Methyl-4,6-heptadien-3-one

Description:

6-Methyl-4,6-heptadien-3-one is an organic compound characterized by its unique structure, which includes a seven-carbon chain with two double bonds and a ketone functional group. This compound features a methyl group at the sixth carbon position and is classified as a conjugated diene due to the alternating double bonds. Its molecular formula is C₇H₁₂O, indicating the presence of carbon, hydrogen, and oxygen atoms. The compound is typically a colorless to pale yellow liquid with a distinctive odor, which may contribute to its applications in flavoring and fragrance industries. It is soluble in organic solvents but has limited solubility in water. The presence of the ketone group suggests that it may participate in various chemical reactions, including nucleophilic addition and condensation reactions. Additionally, due to its unsaturation, it may undergo reactions typical of alkenes, such as hydrogenation or polymerization. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₂O

InChI: InChI=1S/C8H12O/c1-4-8(9)6-5-7(2)3/h5-6H,2,4H2,1,3H3

InChI key: InChIKey=KXMUGEJXADNXJP-UHFFFAOYSA-N

SMILES: C(C=CC(C)=C)(CC)=O

Synonyms:

• 6-Methyl-4,6-heptadien-3-one
• 4,6-Heptadien-3-one, 6-methyl-

4,6-Heptadien-3-one, 6-methyl-

CAS: 100036-65-5

Formula: C₈H₁₂O

Molecular weight: 124.1803

Ref: IN-DA0000MK