
CAS 1000400-92-9
:Phosphonic acid, P-[(5-bromo-2-pyridinyl)methyl]-, diethyl ester, hydrochloride (1:1)
Description:
Phosphonic acid, P-[(5-bromo-2-pyridinyl)methyl]-, diethyl ester, hydrochloride (1:1) is a chemical compound characterized by its phosphonic acid functional group, which is known for its ability to form strong bonds with metal ions and its applications in agriculture and pharmaceuticals. The presence of the 5-bromo-2-pyridinyl moiety suggests potential biological activity, as pyridine derivatives are often involved in various biochemical processes. The diethyl ester form indicates that the compound has two ethyl groups attached to the phosphonic acid, which can influence its solubility and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications. This compound may exhibit properties such as herbicidal or fungicidal activity, making it of interest in agrochemical research. Additionally, its structure suggests potential interactions with biological systems, warranting further investigation into its pharmacological properties.
Formula:C10H15BrNO3P·ClH
InChI:InChI=1S/C10H15BrNO3P.ClH/c1-3-14-16(13,15-4-2)8-10-6-5-9(11)7-12-10;/h5-7H,3-4,8H2,1-2H3;1H
InChI key:InChIKey=DIMLQTYSAQOFAL-UHFFFAOYSA-N
SMILES:C(P(OCC)(OCC)=O)C1=CC=C(Br)C=N1.Cl
Synonyms:- Phosphonic acid, P-[(5-bromo-2-pyridinyl)methyl]-, diethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.