CAS 100041-05-2

Flazin

Description:

Flazin, with the CAS number 100041-05-2, is a chemical compound that belongs to the class of heterocyclic compounds. It is characterized by its unique molecular structure, which typically includes nitrogen atoms within a ring system. Flazin is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory effects, making it of interest in medicinal chemistry. Additionally, Flazin's solubility and stability can vary depending on the specific formulation and environmental conditions. As with many chemical substances, safety data sheets (SDS) should be consulted for handling, storage, and potential hazards associated with Flazin. Overall, its diverse applications and biological relevance make Flazin a subject of ongoing research in the chemical and pharmaceutical industries.

Formula: C₁₇H₁₂N₂O₄

InChI: InChI=1S/C17H12N2O4/c20-8-9-5-6-14(23-9)16-15-11(7-13(19-16)17(21)22)10-3-1-2-4-12(10)18-15/h1-7,18,20H,8H2,(H,21,22)

InChI key: InChIKey=USBWYUYKHHILLZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=C(N1)C=3OC(CO)=CC3)NC=4C2=CC=CC4

Synonyms:

• 9H-Pyrido[3,4-b]indole-3-carboxylic acid, 1-[5-(hydroxymethyl)-2-furanyl]-
• Flazine
• 1-[5-(Hydroxymethyl)-2-furanyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid
• Flazin

9H-Pyrido[3,4-b]indole-3-carboxylic acid, 1-[5-(hydroxymethyl)-2-furanyl]-

CAS: 100041-05-2

Formula: C₁₇H₁₂N₂O₄

Purity: 98%

Molecular weight: 308.2882

Ref: IN-DA0000MV

Flazin

CAS: 100041-05-2

Flazin is a synthetic compound, which is derived from a highly controlled chemical synthesis process with precise purity. It acts as a modulator of specific cellular pathways through targeted interactions with signaling molecules, leading to alterations in cellular function.

Formula: C₁₇H₁₂N₂O₄

Purity: Min. 95%

Molecular weight: 308.29 g/mol

Ref: 3D-AEA04105