CymitQuimica logo

CAS 1000414-38-9

:

(S)-methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate

Description:
(S)-methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate is an organic compound characterized by its specific stereochemistry and functional groups. It features a methyl ester functional group, which contributes to its reactivity and solubility in organic solvents. The presence of a hydroxyl group on the benzofuran moiety enhances its potential for hydrogen bonding, influencing its physical properties such as boiling point and solubility in polar solvents. The compound's structure includes a dihydrobenzofuran ring, which is known for its aromatic characteristics and can participate in various chemical reactions, including electrophilic substitutions. Additionally, the stereochemistry indicated by the (S) configuration suggests that the compound may exhibit specific biological activities or interactions, making it of interest in medicinal chemistry. Its CAS number, 1000414-38-9, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and organic synthesis. Overall, this compound exemplifies the complexity and diversity of organic molecules with potential applications in various scientific domains.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c1-14-11(13)4-7-6-15-10-5-8(12)2-3-9(7)10/h2-3,5,7,12H,4,6H2,1H3/t7-/m1/s1
InChI key:RHMDISFJOKCCAQ-SSDOTTSWSA-N
SMILES:COC(=O)C[C@@H]1COC2=C1C=CC(=C2)O
Found 5 products.