CAS 100047-36-7
:2-Pyridinecarboxylic acid, 4-amino-
Description:
2-Pyridinecarboxylic acid, 4-amino-, also known as 4-amino-2-pyridinecarboxylic acid, is an organic compound characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a pyridine ring. This compound typically appears as a solid and is soluble in polar solvents due to its functional groups. The amino group can participate in hydrogen bonding, enhancing its solubility in water. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the pyridine ring contributes to its aromatic properties, which can influence its reactivity and stability. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with various biological targets, which can be explored in drug development. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c7-4-1-2-8-5(3-4)6(9)10/h1-3H,(H2,7,8)(H,9,10)
InChI key:InChIKey=JRZBTJVSAANBEV-UHFFFAOYSA-N
SMILES:c1cnc(cc1N)C(=O)O
Synonyms:- 4-Amino-2-pyridinecarboxylic acid
- 4-Aminopicolinic acid
- 4-Aminopyridine-2-Carboxylic Acid
- Picolinic acid, 4-amino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Aminopyridine-2-carboxylic acid
CAS:4-Aminopyridine-2-carboxylic acidFormula:C6H6N2O2Purity:97%Color and Shape:Solid-PowderMolecular weight:138.124032-Pyridinecarboxylic acid, 4-amino-
CAS:Formula:C6H6N2O2Purity:97%Color and Shape:SolidMolecular weight:138.12404-Aminopyridine-2-carboxylic acid
CAS:Formula:C6H6N2O2Purity:97%Color and Shape:SolidMolecular weight:138.1264-Aminopicolinic acid
CAS:4-Aminopicolinic acid is a synthetic amine that has been shown to activate plant science. 4-Aminopicolinic acid is a cyclic peptide with two subunits, one of which is 4-amino-3-pyridinecarboxylic acid. This compound has been synthesized from picolinic acid, an agriculturally important compound that is found in plant and animal tissues. The synthesis of 4-aminopicolinic acid involves the reaction of picolinic acid with nitrous oxide, followed by hydrolysis and oxidation to form the desired product. Hplc analyses have confirmed the presence of picolinic acid in extracts from various plants containing this compound.
Formula:C6H6N2O2Purity:Min. 95%Color and Shape:White To Beige Or Pink To Light Brown SolidMolecular weight:138.12 g/mol



