CymitQuimica logo

CAS 100047-45-8

:

2H-Pyrrolo[2,3-d]pyrimidin-2-one, 4-amino-1,7-dihydro- (9CI)

Description:
2H-Pyrrolo[2,3-d]pyrimidin-2-one, 4-amino-1,7-dihydro- (9CI), with the CAS number 100047-45-8, is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings. This compound features a 4-amino group, which contributes to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The structure suggests that it may participate in hydrogen bonding, influencing its interactions in biological systems. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit pharmacological properties. Its unique bicyclic structure allows for diverse chemical modifications, which can enhance its efficacy and selectivity in biological assays. As with many heterocycles, it may also display interesting electronic properties, making it a candidate for further research in various fields, including organic synthesis and materials science.
Formula:C6H6N4O
InChI:InChI=1/C6H6N4O/c7-4-3-1-2-8-5(3)10-6(11)9-4/h1-2H,(H4,7,8,9,10,11)
SMILES:c1cnc2c1c(N)nc([nH]2)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.