
CAS 100047-56-1
:5-Bromo-3-methyl-2(1H)-pyrazinone
Description:
5-Bromo-3-methyl-2(1H)-pyrazinone is a heterocyclic organic compound characterized by its pyrazinone structure, which includes a five-membered ring containing two nitrogen atoms and a carbonyl group. This compound features a bromine atom and a methyl group at specific positions on the pyrazinone ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds of this type may possess biological activity, which can be explored in pharmaceutical applications. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. As with many heterocycles, the stability and reactivity of 5-Bromo-3-methyl-2(1H)-pyrazinone can be affected by environmental conditions such as pH and temperature.
Formula:C5H5BrN2O
InChI:InChI=1S/C5H5BrN2O/c1-3-5(9)7-2-4(6)8-3/h2H,1H3,(H,7,9)
SMILES:Cc1c(=O)[nH]cc(Br)n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2(1H)-Pyrazinone, 5-bromo-3-methyl-
CAS:Formula:C5H5BrN2OPurity:97%Color and Shape:SolidMolecular weight:189.01005-Bromo-2-hydroxy-3-methyl pyrazine
CAS:5-Bromo-2-hydroxy-3-methyl pyrazine belongs to Heterocyclic Compounds - Pyrazine; Intermediate and Building Blocks - Electrophile.Formula:C5H5BrN2OColor and Shape:SolidMolecular weight:189.01Ref: TM-TNU0821
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire5-Bromo-2-hydroxy-3-methyl pyrazine
CAS:Please enquire for more information about 5-Bromo-2-hydroxy-3-methyl pyrazine including the price, delivery time and more detailed product information at the technical inquiry form on this pagePurity:Min. 95%




