CAS 100047-56-1

5-Bromo-3-methyl-2(1H)-pyrazinone

Description:

5-Bromo-3-methyl-2(1H)-pyrazinone is a heterocyclic organic compound characterized by its pyrazinone structure, which includes a five-membered ring containing two nitrogen atoms and a carbonyl group. This compound features a bromine atom and a methyl group at specific positions on the pyrazinone ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds of this type may possess biological activity, which can be explored in pharmaceutical applications. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. As with many heterocycles, the stability and reactivity of 5-Bromo-3-methyl-2(1H)-pyrazinone can be affected by environmental conditions such as pH and temperature.

Formula: C₅H₅BrN₂O

InChI: InChI=1S/C5H5BrN2O/c1-3-5(9)7-2-4(6)8-3/h2H,1H3,(H,7,9)

SMILES: Cc1c(=O)[nH]cc(Br)n1

2(1H)-Pyrazinone, 5-bromo-3-methyl-

CAS: 100047-56-1

Formula: C₅H₅BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 189.0100

Ref: IN-DA0000OL

5-Bromo-3-methylpyrazin-2-ol

CAS: 100047-56-1

5-Bromo-3-methylpyrazin-2-ol

Purity: 97%

Molecular weight: 189.01g/mol

Ref: 54-OR1035803

5-Bromo-2-hydroxy-3-methyl pyrazine

CAS: 100047-56-1

5-Bromo-2-hydroxy-3-methyl pyrazine belongs to Heterocyclic Compounds - Pyrazine; Intermediate and Building Blocks - Electrophile.

Formula: C₅H₅BrN₂O

Color and Shape: Solid

Molecular weight: 189.01

Ref: TM-TNU0821

5-Bromo-3-methylpyrazin-2-ol

CAS: 100047-56-1

Formula: C₅H₅BrN₂O

Purity: 95%

Molecular weight: 189.012

Ref: 10-F334461

5-Bromo-2-hydroxy-3-methyl pyrazine

CAS: 100047-56-1

Please enquire for more information about 5-Bromo-2-hydroxy-3-methyl pyrazine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FB145035