CAS 100049-71-6
:(1-cyclohexylpyrrolidin-3-yl)methanol
Description:
(1-Cyclohexylpyrrolidin-3-yl)methanol, with the CAS number 100049-71-6, is a chemical compound characterized by its unique structure that combines a cyclohexyl group with a pyrrolidine ring and a hydroxymethyl functional group. This compound typically exhibits properties associated with both cyclic amines and alcohols, which may influence its solubility and reactivity. It is likely to be a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the hydroxymethyl group suggests potential for hydrogen bonding, which can affect its boiling point and melting point. Additionally, the cyclohexyl moiety may contribute to hydrophobic characteristics, influencing its interactions in biological systems or organic solvents. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific safety and handling information should be consulted, as with any chemical substance.
Formula:C11H21NO
InChI:InChI=1/C11H21NO/c13-9-10-6-7-12(8-10)11-4-2-1-3-5-11/h10-11,13H,1-9H2
SMILES:C1CCC(CC1)N1CCC(C1)CO
Synonyms:- 3-Pyrrolidinemethanol, 1-Cyclohexyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.