
CAS 10005-29-5
:5,12-Dihydro-4,11-dimethylquino[2,3-b]acridine-7,14-dione
Description:
5,12-Dihydro-4,11-dimethylquino[2,3-b]acridine-7,14-dione, with the CAS number 10005-29-5, is a synthetic organic compound characterized by its complex polycyclic structure, which includes both quinone and acridine moieties. This compound typically exhibits a deep color, often associated with its conjugated system, which can contribute to its potential applications in dyes or pigments. It is known for its biological activity, particularly in the context of medicinal chemistry, where it may exhibit antitumor or antimicrobial properties. The presence of multiple functional groups, including carbonyls and methyl groups, influences its reactivity and solubility in various solvents. Additionally, the compound's unique structure allows for potential interactions with biological macromolecules, making it a subject of interest in drug design and development. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential toxicity or environmental impact.
Formula:C22H16N2O2
InChI:InChI=1S/C22H16N2O2/c1-11-5-3-7-13-19(11)23-17-9-16-18(10-15(17)21(13)25)24-20-12(2)6-4-8-14(20)22(16)26/h3-10H,1-2H3,(H,23,25)(H,24,26)
InChI key:InChIKey=DGWVTMBLTSNMFN-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC3=C(C2)NC=4C(C3=O)=CC=CC4C)NC=5C1=CC=CC5C
Synonyms:- 4,11-Dimethylquinacridone
- 5,12-Dihydro-4,11-dimethylquino[2,3-b]acridine-7,14-dione
- Quino[2,3-b]acridine-7,14-dione, 5,12-dihydro-4,11-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Quino[2,3-b]acridine-7,14-dione, 5,12-dihydro-4,11-dimethyl-
CAS:Formula:C22H16N2O2Molecular weight:340.3746
