
CAS 1000521-37-8
:6-Methoxy-3-pyridinepropanamine
Description:
6-Methoxy-3-pyridinepropanamine, identified by its CAS number 1000521-37-8, is a chemical compound that features a pyridine ring substituted with a methoxy group and a propanamine side chain. This structure suggests that it may exhibit properties typical of both aromatic and aliphatic amines, potentially influencing its reactivity and interaction with biological systems. The presence of the methoxy group can enhance lipophilicity, which may affect its solubility and permeability in biological membranes. Additionally, the pyridine moiety may contribute to its ability to engage in hydrogen bonding and coordination with metal ions. Such characteristics could make it relevant in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. The compound's specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on environmental conditions and the presence of other substances. Overall, 6-Methoxy-3-pyridinepropanamine represents a compound of interest for further research in various chemical and biological applications.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-12-9-5-4-8(7-11-9)3-2-6-10/h4-5,7H,2-3,6,10H2,1H3
InChI key:InChIKey=CXRMNOBHRZVQQS-UHFFFAOYSA-N
SMILES:C(CCN)C=1C=CC(OC)=NC1
Synonyms:- 6-Methoxy-3-pyridinepropanamine
- 3-Pyridinepropanamine, 6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.