
CAS 1000530-48-2
:4-(3-Aminopropyl)-1,2,3-benzenetriol
Description:
4-(3-Aminopropyl)-1,2,3-benzenetriol, identified by its CAS number 1000530-48-2, is an organic compound characterized by the presence of a benzene ring substituted with three hydroxyl (-OH) groups and an aminoalkyl side chain. The compound features a propylamine group, which contributes to its potential biological activity. The hydroxyl groups enhance its solubility in water and may facilitate hydrogen bonding, influencing its reactivity and interaction with other molecules. This compound may exhibit properties typical of phenolic compounds, such as antioxidant activity, and could be of interest in medicinal chemistry for its potential therapeutic applications. Additionally, the amino group may allow for further derivatization, making it a versatile building block in organic synthesis. Its structural features suggest that it could participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C9H13NO3
InChI:InChI=1S/C9H13NO3/c10-5-1-2-6-3-4-7(11)9(13)8(6)12/h3-4,11-13H,1-2,5,10H2
InChI key:InChIKey=IILXZIYKWSWLLC-UHFFFAOYSA-N
SMILES:C(CCN)C1=C(O)C(O)=C(O)C=C1
Synonyms:- 4-(3-Aminopropyl)-1,2,3-benzenetriol
- 1,2,3-Benzenetriol, 4-(3-aminopropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.