CymitQuimica logo

CAS 1000540-61-3

:

3-Chloro-5-fluorobenzenepropanol

Description:
3-Chloro-5-fluorobenzenepropanol is an organic compound characterized by the presence of a benzene ring substituted with both chlorine and fluorine atoms, as well as a propanol group. The chlorine atom is located at the meta position (3-position) relative to the hydroxyl group, while the fluorine atom is situated at the para position (5-position). This compound exhibits properties typical of halogenated alcohols, including potential polarity due to the hydroxyl group, which can engage in hydrogen bonding. The presence of halogens can influence the compound's reactivity, stability, and solubility in various solvents. Additionally, the specific arrangement of substituents can affect its biological activity and potential applications in pharmaceuticals or agrochemicals. As with many halogenated compounds, caution is advised regarding its environmental impact and toxicity, necessitating proper handling and disposal methods. Overall, 3-Chloro-5-fluorobenzenepropanol is a compound of interest in synthetic organic chemistry and may serve as a precursor or intermediate in various chemical syntheses.
Formula:C9H10ClFO
InChI:InChI=1S/C9H10ClFO/c10-8-4-7(2-1-3-12)5-9(11)6-8/h4-6,12H,1-3H2
InChI key:InChIKey=DDTFRCHOFRVRDD-UHFFFAOYSA-N
SMILES:C(CCO)C1=CC(Cl)=CC(F)=C1
Synonyms:
  • 3-Chloro-5-fluorobenzenepropanol
  • Benzenepropanol, 3-chloro-5-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.