CAS 1000571-84-5
:3-Chloro-2-thiophenepropanol
Description:
3-Chloro-2-thiophenepropanol is an organic compound characterized by the presence of a thiophene ring, a five-membered aromatic heterocycle containing sulfur, and a propanol functional group. The compound features a chlorine atom substituted at the third position of the propanol chain, which influences its reactivity and solubility. Typically, compounds like this exhibit moderate polarity due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, enhancing their solubility in polar solvents. The thiophene moiety contributes to the compound's aromatic properties, potentially affecting its electronic characteristics and stability. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its specific reactivity and interactions would depend on the surrounding chemical environment and the presence of other functional groups. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.
Formula:C7H9ClOS
InChI:InChI=1S/C7H9ClOS/c8-6-3-5-10-7(6)2-1-4-9/h3,5,9H,1-2,4H2
InChI key:InChIKey=YFRPVVIQRIFSRP-UHFFFAOYSA-N
SMILES:C(CCO)C1=C(Cl)C=CS1
Synonyms:- 2-Thiophenepropanol, 3-chloro-
- 3-Chloro-2-thiophenepropanol
Sort by
Found 0 products.