CymitQuimica logo

CAS 1000573-04-5

:

Ethyl 2-[4-[[3-(methylsulfonyl)-1,2,4-thiadiazol-5-yl]oxy]phenoxy]propanoate

Description:
Ethyl 2-[4-[[3-(methylsulfonyl)-1,2,4-thiadiazol-5-yl]oxy]phenoxy]propanoate, identified by its CAS number 1000573-04-5, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a thiadiazole moiety. This compound typically exhibits properties associated with both ester and aromatic functionalities, contributing to its potential solubility in organic solvents. The presence of the methylsulfonyl group enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical applications. The thiadiazole ring is known for its diverse biological activities, including antimicrobial and antifungal properties. Additionally, the compound's structure suggests potential interactions with various biological targets, which could be explored in drug development. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further research in medicinal chemistry and agrochemical applications.
Formula:C14H16N2O6S2
InChI:InChI=1S/C14H16N2O6S2/c1-4-20-12(17)9(2)21-10-5-7-11(8-6-10)22-14-15-13(16-23-14)24(3,18)19/h5-9H,4H2,1-3H3
InChI key:InChIKey=JTQPXXBRLXCCSE-UHFFFAOYSA-N
SMILES:O(C1=NC(S(C)(=O)=O)=NS1)C2=CC=C(OC(C(OCC)=O)C)C=C2
Synonyms:
  • Propanoic acid, 2-[4-[[3-(methylsulfonyl)-1,2,4-thiadiazol-5-yl]oxy]phenoxy]-, ethyl ester
  • Ethyl 2-[4-[[3-(methylsulfonyl)-1,2,4-thiadiazol-5-yl]oxy]phenoxy]propanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.