
CAS 1000573-88-5
:1-(3,4-Dichlorophenyl)-2,5-dihydro-5-oxo-N-phenyl-1H-1,2,4-triazole-3-carboxamide
Description:
1-(3,4-Dichlorophenyl)-2,5-dihydro-5-oxo-N-phenyl-1H-1,2,4-triazole-3-carboxamide, with CAS number 1000573-88-5, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a dichlorophenyl group, contributing to its potential biological activity and lipophilicity. The presence of the carboxamide functional group enhances its solubility in polar solvents and may influence its interaction with biological targets. The compound is often studied for its potential applications in pharmaceuticals, particularly in the development of antifungal or antimicrobial agents, due to the triazole moiety's known efficacy in these areas. Its molecular structure suggests that it may exhibit significant pharmacological properties, although specific activity and toxicity profiles would require empirical investigation. As with many synthetic compounds, proper handling and safety measures should be observed, given the potential for biological activity and environmental impact.
Formula:C15H10Cl2N4O2
InChI:InChI=1S/C15H10Cl2N4O2/c16-11-7-6-10(8-12(11)17)21-15(23)19-13(20-21)14(22)18-9-4-2-1-3-5-9/h1-8H,(H,18,22)(H,19,20,23)
InChI key:InChIKey=GMENZWVESJQGIU-UHFFFAOYSA-N
SMILES:O=C1N(N=C(C(NC2=CC=CC=C2)=O)N1)C3=CC(Cl)=C(Cl)C=C3
Synonyms:- 1-(3,4-Dichlorophenyl)-2,5-dihydro-5-oxo-N-phenyl-1H-1,2,4-triazole-3-carboxamide
- 1H-1,2,4-Triazole-3-carboxamide, 1-(3,4-dichlorophenyl)-2,5-dihydro-5-oxo-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.