CymitQuimica logo

CAS 1000574-06-0

:

2,5-Dihydro-N,N-dimethyl-5-oxo-1-phenyl-1H-1,2,4-triazole-3-carboxamide

Description:
2,5-Dihydro-N,N-dimethyl-5-oxo-1-phenyl-1H-1,2,4-triazole-3-carboxamide is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the phenyl group indicates that it may exhibit aromatic properties, which can influence its solubility and reactivity. The dimethyl substitution on the nitrogen atoms suggests that it may have specific steric and electronic properties, potentially affecting its interaction with biological targets. This compound may be of interest in pharmaceutical research due to its structural features, which could impart various biological activities. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2,5-Dihydro-N,N-dimethyl-5-oxo-1-phenyl-1H-1,2,4-triazole-3-carboxamide represents a unique structure that may have applications in medicinal chemistry and related fields.
Formula:C11H12N4O2
InChI:InChI=1S/C11H12N4O2/c1-14(2)10(16)9-12-11(17)15(13-9)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,12,13,17)
InChI key:InChIKey=XDQKWFXARKSOIL-UHFFFAOYSA-N
SMILES:O=C1N(N=C(C(N(C)C)=O)N1)C2=CC=CC=C2
Synonyms:
  • 2,5-Dihydro-N,N-dimethyl-5-oxo-1-phenyl-1H-1,2,4-triazole-3-carboxamide
  • 1H-1,2,4-Triazole-3-carboxamide, 2,5-dihydro-N,N-dimethyl-5-oxo-1-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.