CAS 1000576-45-3

5,7-Dichloro-N-(3-chlorophenyl)-N-methylthiazolo[4,5-d]pyrimidine-2-sulfonamide

Description:

5,7-Dichloro-N-(3-chlorophenyl)-N-methylthiazolo[4,5-d]pyrimidine-2-sulfonamide is a synthetic organic compound characterized by its complex structure, which includes a thiazolo-pyrimidine core and sulfonamide functional group. This compound features multiple chlorine substituents, which can influence its reactivity and biological activity. The presence of the sulfonamide group suggests potential applications in medicinal chemistry, particularly as an antibacterial or antiviral agent, as sulfonamides are known for their therapeutic properties. The thiazolo and pyrimidine rings contribute to the compound's heterocyclic nature, which is often associated with diverse pharmacological activities. Additionally, the compound's solubility, stability, and interaction with biological targets can be affected by its substituents and overall molecular geometry. As with many synthetic compounds, understanding its characteristics requires consideration of its synthesis, potential applications, and safety profile, particularly in terms of toxicity and environmental impact. Further studies would be necessary to elucidate its specific properties and potential uses in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₂H₇Cl₃N₄O₂S₂

InChI: InChI=1S/C12H7Cl3N4O2S2/c1-19(7-4-2-3-6(13)5-7)23(20,21)12-18-10-8(22-12)9(14)16-11(15)17-10/h2-5H,1H3

InChI key: InChIKey=GWKJAKLPPMIQQL-UHFFFAOYSA-N

SMILES: ClC1=C2C(N=C(S(N(C)C3=CC(Cl)=CC=C3)(=O)=O)S2)=NC(Cl)=N1

Synonyms:

• 5,7-Dichloro-N-(3-chlorophenyl)-N-methylthiazolo[4,5-d]pyrimidine-2-sulfonamide
• Thiazolo[4,5-d]pyrimidine-2-sulfonamide, 5,7-dichloro-N-(3-chlorophenyl)-N-methyl-